C12H25N5O2 — CID 54252236
2-[(4S,7S,8S)-4,7-diamino-8-methyl-5,6-dioxodecyl]guanidine (PubChem CID 54252236) has the molecular formula C12H25N5O2 and a molecular weight of 271.37 g/mol. Its IUPAC name is 2-[(4S,7S,8S)-4,7-diamino-8-methyl-5,6-dioxodecyl]guanidine.
| Compound Name | 2-[(4S,7S,8S)-4,7-diamino-8-methyl-5,6-dioxodecyl]guanidine |
|---|---|
| PubChem CID | 54252236 |
| Molecular Formula | C12H25N5O2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 2-[(4S,7S,8S)-4,7-diamino-8-methyl-5,6-dioxodecyl]guanidine |
| SMILES | CC[C@H](C)[C@H](N)C(=O)C(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C12H25N5O2/c1-3-7(2)9(14)11(19)10(18)8(13)5-4-6-17-12(15)16/h7-9H,3-6,13-14H2,1-2H3,(H4,15,16,17)/t7-,8-,9-/m0/s1 |
| InChIKey | QXOJOTKWDPAWQC-CIUDSAMLSA-N |
| XLogP | -1.12 |
| TPSA | 150.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|