About chloro-(4-chloro-3,5-dimethylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane
chloro-(4-chloro-3,5-dimethylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane (PubChem CID 54252513) has the molecular formula C10H13Cl2O2PS
and a molecular weight of 299.16 g/mol. Its IUPAC name is chloro-(4-chloro-3,5-dimethylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane.
Molecular Properties
| Compound Name | chloro-(4-chloro-3,5-dimethylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane |
| PubChem CID | 54252513 |
| Molecular Formula | C10H13Cl2O2PS |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | chloro-(4-chloro-3,5-dimethylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane |
| SMILES | CCOP(=S)(Cl)Oc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C10H13Cl2O2PS/c1-4-13-15(12,16)14-9-5-7(2)10(11)8(3)6-9/h5-6H,4H2,1-3H3 |
| InChIKey | QXTLRCYQJSRMKJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloro-(4-chloro-3,5-dimethylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-(4-chloro-3,5-dimethylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane?
The IUPAC name of chloro-(4-chloro-3,5-dimethylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane (CID 54252513) is chloro-(4-chloro-3,5-dimethylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane.
What is the SMILES notation for chloro-(4-chloro-3,5-dimethylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane?
The canonical SMILES for chloro-(4-chloro-3,5-dimethylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane is CCOP(=S)(Cl)Oc1cc(C)c(Cl)c(C)c1.
What is the InChIKey of chloro-(4-chloro-3,5-dimethylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane?
The InChIKey is QXTLRCYQJSRMKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Cl2O2PS/c1-4-13-15(12,16)14-9-5-7(2)10(11)8(3)6-9/h5-6H,4H2,1-3H3.
What are the key properties of chloro-(4-chloro-3,5-dimethylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane?
chloro-(4-chloro-3,5-dimethylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane has a molecular weight of 299.16 g/mol, XLogP of 4.84, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-(4-chloro-3,5-dimethylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane is sourced from PubChem (CID 54252513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).