About 4,5-bis(hept-1-enyl)-3,6-bis(9-isocyanatononyl)cyclohexene
4,5-bis(hept-1-enyl)-3,6-bis(9-isocyanatononyl)cyclohexene (PubChem CID 54252565) has the molecular formula C40H68N2O2
and a molecular weight of 609.00 g/mol. Its IUPAC name is 4,5-bis(hept-1-enyl)-3,6-bis(9-isocyanatononyl)cyclohexene.
Molecular Properties
| Compound Name | 4,5-bis(hept-1-enyl)-3,6-bis(9-isocyanatononyl)cyclohexene |
| PubChem CID | 54252565 |
| Molecular Formula | C40H68N2O2 |
| Molecular Weight | 609.00 g/mol |
| Exact Mass | 608.53 |
| IUPAC Name | 4,5-bis(hept-1-enyl)-3,6-bis(9-isocyanatononyl)cyclohexene |
| SMILES | CCCCCC=CC1C(CCCCCCCCCN=C=O)C=CC(CCCCCCCCCN=C=O)C1C=CCCCCC |
| InChI | InChI=1S/C40H68N2O2/c1-3-5-7-15-23-29-39-37(27-21-17-11-9-13-19-25-33-41-35-43)31-32-38(40(39)30-24-16-8-6-4-2)28-22-18-12-10-14-20-26-34-42-36-44/h23-24,29-32,37-40H,3-22,25-28,33-34H2,1-2H3 |
| InChIKey | QXUHBZADGFKYEF-UHFFFAOYSA-N |
| XLogP | 12.21 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 609.00 |
| LogP ≤ 5 | 12.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4,5-bis(hept-1-enyl)-3,6-bis(9-isocyanatononyl)cyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(hept-1-enyl)-3,6-bis(9-isocyanatononyl)cyclohexene?
The IUPAC name of 4,5-bis(hept-1-enyl)-3,6-bis(9-isocyanatononyl)cyclohexene (CID 54252565) is 4,5-bis(hept-1-enyl)-3,6-bis(9-isocyanatononyl)cyclohexene.
What is the SMILES notation for 4,5-bis(hept-1-enyl)-3,6-bis(9-isocyanatononyl)cyclohexene?
The canonical SMILES for 4,5-bis(hept-1-enyl)-3,6-bis(9-isocyanatononyl)cyclohexene is CCCCCC=CC1C(CCCCCCCCCN=C=O)C=CC(CCCCCCCCCN=C=O)C1C=CCCCCC.
What is the InChIKey of 4,5-bis(hept-1-enyl)-3,6-bis(9-isocyanatononyl)cyclohexene?
The InChIKey is QXUHBZADGFKYEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H68N2O2/c1-3-5-7-15-23-29-39-37(27-21-17-11-9-13-19-25-33-41-35-43)31-32-38(40(39)30-24-16-8-6-4-2)28-22-18-12-10-14-20-26-34-42-36-44/h23-24,29-32,37-40H,3-22,25-28,33-34H2,1-2H3.
What are the key properties of 4,5-bis(hept-1-enyl)-3,6-bis(9-isocyanatononyl)cyclohexene?
4,5-bis(hept-1-enyl)-3,6-bis(9-isocyanatononyl)cyclohexene has a molecular weight of 609.00 g/mol, XLogP of 12.21, 30 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(hept-1-enyl)-3,6-bis(9-isocyanatononyl)cyclohexene is sourced from PubChem (CID 54252565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).