C29H37ClN2O4 — CID 542526
2-[4-[[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]-(2-chlorophenyl)methyl]-N-(2-hydroxyethyl)-3-methylanilino]ethanol (PubChem CID 542526) has the molecular formula C29H37ClN2O4 and a molecular weight of 513.08 g/mol. Its IUPAC name is 2-[4-[[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]-(2-chlorophenyl)methyl]-N-(2-hydroxyethyl)-3-methylanilino]ethanol.
| Compound Name | 2-[4-[[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]-(2-chlorophenyl)methyl]-N-(2-hydroxyethyl)-3-methylanilino]ethanol |
|---|---|
| PubChem CID | 542526 |
| Molecular Formula | C29H37ClN2O4 |
| Molecular Weight | 513.08 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 2-[4-[[4-[bis(2-hydroxyethyl)amino]-2-methylphenyl]-(2-chlorophenyl)methyl]-N-(2-hydroxyethyl)-3-methylanilino]ethanol |
| SMILES | Cc1cc(N(CCO)CCO)ccc1C(c1ccc(N(CCO)CCO)cc1C)c1ccccc1Cl |
| InChI | InChI=1S/C29H37ClN2O4/c1-21-19-23(31(11-15-33)12-16-34)7-9-25(21)29(27-5-3-4-6-28(27)30)26-10-8-24(20-22(26)2)32(13-17-35)14-18-36/h3-10,19-20,29,33-36H,11-18H2,1-2H3 |
| InChIKey | DFDZPXSITVUUKS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.08 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|