C17H27ClN4O — CID 54252664
3-[6-[(6-chloro-3-pyridinyl)methyl-ethylamino]-1,5-dimethyl-2,4-dihydropyrimidin-3-yl]propan-1-ol (PubChem CID 54252664) has the molecular formula C17H27ClN4O and a molecular weight of 338.88 g/mol. Its IUPAC name is 3-[6-[(6-chloro-3-pyridinyl)methyl-ethylamino]-1,5-dimethyl-2,4-dihydropyrimidin-3-yl]propan-1-ol.
| Compound Name | 3-[6-[(6-chloro-3-pyridinyl)methyl-ethylamino]-1,5-dimethyl-2,4-dihydropyrimidin-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 54252664 |
| Molecular Formula | C17H27ClN4O |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 3-[6-[(6-chloro-3-pyridinyl)methyl-ethylamino]-1,5-dimethyl-2,4-dihydropyrimidin-3-yl]propan-1-ol |
| SMILES | CCN(Cc1ccc(Cl)nc1)C1=C(C)CN(CCCO)CN1C |
| InChI | InChI=1S/C17H27ClN4O/c1-4-22(12-15-6-7-16(18)19-10-15)17-14(2)11-21(8-5-9-23)13-20(17)3/h6-7,10,23H,4-5,8-9,11-13H2,1-3H3 |
| InChIKey | QXWCDYACBSJSJJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|