About 7-chloro-5-(2-fluorophenyl)-N'-methoxy-3H-1,4-benzodiazepine-2-carboximidamide
7-chloro-5-(2-fluorophenyl)-N'-methoxy-3H-1,4-benzodiazepine-2-carboximidamide (PubChem CID 54253073) has the molecular formula C17H14ClFN4O
and a molecular weight of 344.78 g/mol. Its IUPAC name is 7-chloro-5-(2-fluorophenyl)-N'-methoxy-3H-1,4-benzodiazepine-2-carboximidamide.
Molecular Properties
| Compound Name | 7-chloro-5-(2-fluorophenyl)-N'-methoxy-3H-1,4-benzodiazepine-2-carboximidamide |
| PubChem CID | 54253073 |
| Molecular Formula | C17H14ClFN4O |
| Molecular Weight | 344.78 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 7-chloro-5-(2-fluorophenyl)-N'-methoxy-3H-1,4-benzodiazepine-2-carboximidamide |
| SMILES | CON=C(N)C1=Nc2ccc(Cl)cc2C(c2ccccc2F)=NC1 |
| InChI | InChI=1S/C17H14ClFN4O/c1-24-23-17(20)15-9-21-16(11-4-2-3-5-13(11)19)12-8-10(18)6-7-14(12)22-15/h2-8H,9H2,1H3,(H2,20,23) |
| InChIKey | QYCVSTVLKUNAKJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.78 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-5-(2-fluorophenyl)-N'-methoxy-3H-1,4-benzodiazepine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5-(2-fluorophenyl)-N'-methoxy-3H-1,4-benzodiazepine-2-carboximidamide?
The IUPAC name of 7-chloro-5-(2-fluorophenyl)-N'-methoxy-3H-1,4-benzodiazepine-2-carboximidamide (CID 54253073) is 7-chloro-5-(2-fluorophenyl)-N'-methoxy-3H-1,4-benzodiazepine-2-carboximidamide.
What is the SMILES notation for 7-chloro-5-(2-fluorophenyl)-N'-methoxy-3H-1,4-benzodiazepine-2-carboximidamide?
The canonical SMILES for 7-chloro-5-(2-fluorophenyl)-N'-methoxy-3H-1,4-benzodiazepine-2-carboximidamide is CON=C(N)C1=Nc2ccc(Cl)cc2C(c2ccccc2F)=NC1.
What is the InChIKey of 7-chloro-5-(2-fluorophenyl)-N'-methoxy-3H-1,4-benzodiazepine-2-carboximidamide?
The InChIKey is QYCVSTVLKUNAKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14ClFN4O/c1-24-23-17(20)15-9-21-16(11-4-2-3-5-13(11)19)12-8-10(18)6-7-14(12)22-15/h2-8H,9H2,1H3,(H2,20,23).
What are the key properties of 7-chloro-5-(2-fluorophenyl)-N'-methoxy-3H-1,4-benzodiazepine-2-carboximidamide?
7-chloro-5-(2-fluorophenyl)-N'-methoxy-3H-1,4-benzodiazepine-2-carboximidamide has a molecular weight of 344.78 g/mol, XLogP of 3.32, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5-(2-fluorophenyl)-N'-methoxy-3H-1,4-benzodiazepine-2-carboximidamide is sourced from PubChem (CID 54253073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).