About 1-hydroxy-2,4-dihydropyridin-3-one
1-hydroxy-2,4-dihydropyridin-3-one (PubChem CID 54253218) has the molecular formula C5H7NO2
and a molecular weight of 113.12 g/mol. Its IUPAC name is 1-hydroxy-2,4-dihydropyridin-3-one.
Molecular Properties
| Compound Name | 1-hydroxy-2,4-dihydropyridin-3-one |
| PubChem CID | 54253218 |
| Molecular Formula | C5H7NO2 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.05 |
| IUPAC Name | 1-hydroxy-2,4-dihydropyridin-3-one |
| SMILES | O=C1CC=CN(O)C1 |
| InChI | InChI=1S/C5H7NO2/c7-5-2-1-3-6(8)4-5/h1,3,8H,2,4H2 |
| InChIKey | QYFKOFDAZIXIOS-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-hydroxy-2,4-dihydropyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2,4-dihydropyridin-3-one?
The IUPAC name of 1-hydroxy-2,4-dihydropyridin-3-one (CID 54253218) is 1-hydroxy-2,4-dihydropyridin-3-one.
What is the SMILES notation for 1-hydroxy-2,4-dihydropyridin-3-one?
The canonical SMILES for 1-hydroxy-2,4-dihydropyridin-3-one is O=C1CC=CN(O)C1.
What is the InChIKey of 1-hydroxy-2,4-dihydropyridin-3-one?
The InChIKey is QYFKOFDAZIXIOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2/c7-5-2-1-3-6(8)4-5/h1,3,8H,2,4H2.
What are the key properties of 1-hydroxy-2,4-dihydropyridin-3-one?
1-hydroxy-2,4-dihydropyridin-3-one has a molecular weight of 113.12 g/mol, XLogP of 0.16, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2,4-dihydropyridin-3-one is sourced from PubChem (CID 54253218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).