C25H23ClN2O5S — CID 54253372
3-(3-chloro-4,5-dihydroxyphenyl)-N-[4-(2,3-dihydro-1H-inden-2-ylsulfamoyl)phenyl]-N-methylprop-2-enamide (PubChem CID 54253372) has the molecular formula C25H23ClN2O5S and a molecular weight of 498.99 g/mol. Its IUPAC name is 3-(3-chloro-4,5-dihydroxyphenyl)-N-[4-(2,3-dihydro-1H-inden-2-ylsulfamoyl)phenyl]-N-methylprop-2-enamide.
| Compound Name | 3-(3-chloro-4,5-dihydroxyphenyl)-N-[4-(2,3-dihydro-1H-inden-2-ylsulfamoyl)phenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 54253372 |
| Molecular Formula | C25H23ClN2O5S |
| Molecular Weight | 498.99 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 3-(3-chloro-4,5-dihydroxyphenyl)-N-[4-(2,3-dihydro-1H-inden-2-ylsulfamoyl)phenyl]-N-methylprop-2-enamide |
| SMILES | CN(C(=O)C=Cc1cc(O)c(O)c(Cl)c1)c1ccc(S(=O)(=O)NC2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C25H23ClN2O5S/c1-28(24(30)11-6-16-12-22(26)25(31)23(29)13-16)20-7-9-21(10-8-20)34(32,33)27-19-14-17-4-2-3-5-18(17)15-19/h2-13,19,27,29,31H,14-15H2,1H3 |
| InChIKey | QYHYLBMBHZNGGD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.99 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|