C11H14N2O5S — CID 54253789
2-(ethylsulfamoyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide (PubChem CID 54253789) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is 2-(ethylsulfamoyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide.
| Compound Name | 2-(ethylsulfamoyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
|---|---|
| PubChem CID | 54253789 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-(ethylsulfamoyl)-2,3-dihydro-1,4-benzodioxine-5-carboxamide |
| SMILES | CCNS(=O)(=O)C1COc2c(cccc2C(N)=O)O1 |
| InChI | InChI=1S/C11H14N2O5S/c1-2-13-19(15,16)9-6-17-10-7(11(12)14)4-3-5-8(10)18-9/h3-5,9,13H,2,6H2,1H3,(H2,12,14) |
| InChIKey | QYPNERXMXXHMBM-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |