C6H9N3O — CID 54253937
1-[[(2R,3R)-3-methyloxiran-2-yl]methyl]-1,2,4-triazole (PubChem CID 54253937) has the molecular formula C6H9N3O and a molecular weight of 139.16 g/mol. Its IUPAC name is 1-[[(2R,3R)-3-methyloxiran-2-yl]methyl]-1,2,4-triazole.
| Compound Name | 1-[[(2R,3R)-3-methyloxiran-2-yl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 54253937 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | 1-[[(2R,3R)-3-methyloxiran-2-yl]methyl]-1,2,4-triazole |
| SMILES | C[C@H]1O[C@@H]1Cn1cncn1 |
| InChI | InChI=1S/C6H9N3O/c1-5-6(10-5)2-9-4-7-3-8-9/h3-6H,2H2,1H3/t5-,6-/m1/s1 |
| InChIKey | QYRVXJMYTZBJFO-PHDIDXHHSA-N |
| XLogP | 0.07 |
| TPSA | 43.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|