About (2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoate
(2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoate (PubChem CID 54254071) has the molecular formula C26H29N3O8
and a molecular weight of 511.53 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoate |
| PubChem CID | 54254071 |
| Molecular Formula | C26H29N3O8 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoate |
| SMILES | NCCCC[C@@H](C(=O)On1c(O)ccc1O)N(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H29N3O8/c27-16-8-7-13-21(24(32)37-29-22(30)14-15-23(29)31)28(25(33)35-17-19-9-3-1-4-10-19)26(34)36-18-20-11-5-2-6-12-20/h1-6,9-12,14-15,21,30-31H,7-8,13,16-18,27H2/t21-/m0/s1 |
| InChIKey | QYUATSVZNCRJTN-NRFANRHFSA-N |
| XLogP | 3.33 |
| TPSA | 153.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoate (CID 54254071) is (2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoate is NCCCC[C@@H](C(=O)On1c(O)ccc1O)N(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoate?
The InChIKey is QYUATSVZNCRJTN-NRFANRHFSA-N. The full InChI is InChI=1S/C26H29N3O8/c27-16-8-7-13-21(24(32)37-29-22(30)14-15-23(29)31)28(25(33)35-17-19-9-3-1-4-10-19)26(34)36-18-20-11-5-2-6-12-20/h1-6,9-12,14-15,21,30-31H,7-8,13,16-18,27H2/t21-/m0/s1.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoate?
(2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoate has a molecular weight of 511.53 g/mol, XLogP of 3.33, 11 rotatable bonds, 3 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) (2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoate is sourced from PubChem (CID 54254071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).