About 6,7-dinitroquinoline-2,3-dione
6,7-dinitroquinoline-2,3-dione (PubChem CID 54254601) has the molecular formula C9H3N3O6
and a molecular weight of 249.14 g/mol. Its IUPAC name is 6,7-dinitroquinoline-2,3-dione.
Molecular Properties
| Compound Name | 6,7-dinitroquinoline-2,3-dione |
| PubChem CID | 54254601 |
| Molecular Formula | C9H3N3O6 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 6,7-dinitroquinoline-2,3-dione |
| SMILES | O=C1C=c2cc([N+](=O)[O-])c([N+](=O)[O-])cc2=NC1=O |
| InChI | InChI=1S/C9H3N3O6/c13-8-2-4-1-6(11(15)16)7(12(17)18)3-5(4)10-9(8)14/h1-3H |
| InChIKey | QZCSYQQUUVEFLV-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 132.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dinitroquinoline-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dinitroquinoline-2,3-dione?
The IUPAC name of 6,7-dinitroquinoline-2,3-dione (CID 54254601) is 6,7-dinitroquinoline-2,3-dione.
What is the SMILES notation for 6,7-dinitroquinoline-2,3-dione?
The canonical SMILES for 6,7-dinitroquinoline-2,3-dione is O=C1C=c2cc([N+](=O)[O-])c([N+](=O)[O-])cc2=NC1=O.
What is the InChIKey of 6,7-dinitroquinoline-2,3-dione?
The InChIKey is QZCSYQQUUVEFLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3N3O6/c13-8-2-4-1-6(11(15)16)7(12(17)18)3-5(4)10-9(8)14/h1-3H.
What are the key properties of 6,7-dinitroquinoline-2,3-dione?
6,7-dinitroquinoline-2,3-dione has a molecular weight of 249.14 g/mol, XLogP of -0.99, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dinitroquinoline-2,3-dione is sourced from PubChem (CID 54254601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).