About 5,6-diethyl-N-methylcyclohex-3-en-1-amine;methanamine
5,6-diethyl-N-methylcyclohex-3-en-1-amine;methanamine (PubChem CID 54254781) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is 5,6-diethyl-N-methylcyclohex-3-en-1-amine;methanamine.
Molecular Properties
| Compound Name | 5,6-diethyl-N-methylcyclohex-3-en-1-amine;methanamine |
| PubChem CID | 54254781 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 5,6-diethyl-N-methylcyclohex-3-en-1-amine;methanamine |
| SMILES | CCC1C=CCC(NC)C1CC.CN |
| InChI | InChI=1S/C11H21N.CH5N/c1-4-9-7-6-8-11(12-3)10(9)5-2;1-2/h6-7,9-12H,4-5,8H2,1-3H3;2H2,1H3 |
| InChIKey | QZGCNGQYYADQBV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,6-diethyl-N-methylcyclohex-3-en-1-amine;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diethyl-N-methylcyclohex-3-en-1-amine;methanamine?
The IUPAC name of 5,6-diethyl-N-methylcyclohex-3-en-1-amine;methanamine (CID 54254781) is 5,6-diethyl-N-methylcyclohex-3-en-1-amine;methanamine.
What is the SMILES notation for 5,6-diethyl-N-methylcyclohex-3-en-1-amine;methanamine?
The canonical SMILES for 5,6-diethyl-N-methylcyclohex-3-en-1-amine;methanamine is CCC1C=CCC(NC)C1CC.CN.
What is the InChIKey of 5,6-diethyl-N-methylcyclohex-3-en-1-amine;methanamine?
The InChIKey is QZGCNGQYYADQBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N.CH5N/c1-4-9-7-6-8-11(12-3)10(9)5-2;1-2/h6-7,9-12H,4-5,8H2,1-3H3;2H2,1H3.
What are the key properties of 5,6-diethyl-N-methylcyclohex-3-en-1-amine;methanamine?
5,6-diethyl-N-methylcyclohex-3-en-1-amine;methanamine has a molecular weight of 198.35 g/mol, XLogP of 2.16, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diethyl-N-methylcyclohex-3-en-1-amine;methanamine is sourced from PubChem (CID 54254781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).