About (3,3-dimethyl-2-piperidin-1-yl-2H-1-benzofuran-5-yl) N,N-dimethylsulfamate
(3,3-dimethyl-2-piperidin-1-yl-2H-1-benzofuran-5-yl) N,N-dimethylsulfamate (PubChem CID 54254857) has the molecular formula C17H26N2O4S
and a molecular weight of 354.47 g/mol. Its IUPAC name is (3,3-dimethyl-2-piperidin-1-yl-2H-1-benzofuran-5-yl) N,N-dimethylsulfamate.
Molecular Properties
| Compound Name | (3,3-dimethyl-2-piperidin-1-yl-2H-1-benzofuran-5-yl) N,N-dimethylsulfamate |
| PubChem CID | 54254857 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (3,3-dimethyl-2-piperidin-1-yl-2H-1-benzofuran-5-yl) N,N-dimethylsulfamate |
| SMILES | CN(C)S(=O)(=O)Oc1ccc2c(c1)C(C)(C)C(N1CCCCC1)O2 |
| InChI | InChI=1S/C17H26N2O4S/c1-17(2)14-12-13(23-24(20,21)18(3)4)8-9-15(14)22-16(17)19-10-6-5-7-11-19/h8-9,12,16H,5-7,10-11H2,1-4H3 |
| InChIKey | QZHVJEMXAHXLHA-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3,3-dimethyl-2-piperidin-1-yl-2H-1-benzofuran-5-yl) N,N-dimethylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethyl-2-piperidin-1-yl-2H-1-benzofuran-5-yl) N,N-dimethylsulfamate?
The IUPAC name of (3,3-dimethyl-2-piperidin-1-yl-2H-1-benzofuran-5-yl) N,N-dimethylsulfamate (CID 54254857) is (3,3-dimethyl-2-piperidin-1-yl-2H-1-benzofuran-5-yl) N,N-dimethylsulfamate.
What is the SMILES notation for (3,3-dimethyl-2-piperidin-1-yl-2H-1-benzofuran-5-yl) N,N-dimethylsulfamate?
The canonical SMILES for (3,3-dimethyl-2-piperidin-1-yl-2H-1-benzofuran-5-yl) N,N-dimethylsulfamate is CN(C)S(=O)(=O)Oc1ccc2c(c1)C(C)(C)C(N1CCCCC1)O2.
What is the InChIKey of (3,3-dimethyl-2-piperidin-1-yl-2H-1-benzofuran-5-yl) N,N-dimethylsulfamate?
The InChIKey is QZHVJEMXAHXLHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O4S/c1-17(2)14-12-13(23-24(20,21)18(3)4)8-9-15(14)22-16(17)19-10-6-5-7-11-19/h8-9,12,16H,5-7,10-11H2,1-4H3.
What are the key properties of (3,3-dimethyl-2-piperidin-1-yl-2H-1-benzofuran-5-yl) N,N-dimethylsulfamate?
(3,3-dimethyl-2-piperidin-1-yl-2H-1-benzofuran-5-yl) N,N-dimethylsulfamate has a molecular weight of 354.47 g/mol, XLogP of 2.35, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethyl-2-piperidin-1-yl-2H-1-benzofuran-5-yl) N,N-dimethylsulfamate is sourced from PubChem (CID 54254857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).