About 2-(3-tricyclo[5.2.1.02,6]decanyl)acetaldehyde
2-(3-tricyclo[5.2.1.02,6]decanyl)acetaldehyde (PubChem CID 54255264) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is 2-(3-tricyclo[5.2.1.02,6]decanyl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(3-tricyclo[5.2.1.02,6]decanyl)acetaldehyde |
| PubChem CID | 54255264 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 2-(3-tricyclo[5.2.1.02,6]decanyl)acetaldehyde |
| SMILES | O=CCC1CCC2C3CCC(C3)C12 |
| InChI | InChI=1S/C12H18O/c13-6-5-8-3-4-11-9-1-2-10(7-9)12(8)11/h6,8-12H,1-5,7H2 |
| InChIKey | QZOXTJJRQCIWAO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-tricyclo[5.2.1.02,6]decanyl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-tricyclo[5.2.1.02,6]decanyl)acetaldehyde?
The IUPAC name of 2-(3-tricyclo[5.2.1.02,6]decanyl)acetaldehyde (CID 54255264) is 2-(3-tricyclo[5.2.1.02,6]decanyl)acetaldehyde.
What is the SMILES notation for 2-(3-tricyclo[5.2.1.02,6]decanyl)acetaldehyde?
The canonical SMILES for 2-(3-tricyclo[5.2.1.02,6]decanyl)acetaldehyde is O=CCC1CCC2C3CCC(C3)C12.
What is the InChIKey of 2-(3-tricyclo[5.2.1.02,6]decanyl)acetaldehyde?
The InChIKey is QZOXTJJRQCIWAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c13-6-5-8-3-4-11-9-1-2-10(7-9)12(8)11/h6,8-12H,1-5,7H2.
What are the key properties of 2-(3-tricyclo[5.2.1.02,6]decanyl)acetaldehyde?
2-(3-tricyclo[5.2.1.02,6]decanyl)acetaldehyde has a molecular weight of 178.27 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-tricyclo[5.2.1.02,6]decanyl)acetaldehyde is sourced from PubChem (CID 54255264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).