C17H13ClF5NO5S — CID 54255560
[4-chloro-2-methylsulfonyl-3-(2,2,3,3,3-pentafluoropropoxy)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone (PubChem CID 54255560) has the molecular formula C17H13ClF5NO5S and a molecular weight of 473.80 g/mol. Its IUPAC name is [4-chloro-2-methylsulfonyl-3-(2,2,3,3,3-pentafluoropropoxy)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone.
| Compound Name | [4-chloro-2-methylsulfonyl-3-(2,2,3,3,3-pentafluoropropoxy)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 54255560 |
| Molecular Formula | C17H13ClF5NO5S |
| Molecular Weight | 473.80 g/mol |
| Exact Mass | 473.01 |
| IUPAC Name | [4-chloro-2-methylsulfonyl-3-(2,2,3,3,3-pentafluoropropoxy)phenyl]-(5-cyclopropyl-1,2-oxazol-4-yl)methanone |
| SMILES | CS(=O)(=O)c1c(C(=O)c2cnoc2C2CC2)ccc(Cl)c1OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H13ClF5NO5S/c1-30(26,27)15-9(12(25)10-6-24-29-13(10)8-2-3-8)4-5-11(18)14(15)28-7-16(19,20)17(21,22)23/h4-6,8H,2-3,7H2,1H3 |
| InChIKey | QZUQASJNYATSOZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.80 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|