About 4-(difluoromethyl)-1H-1,2,4-triazol-5-one
4-(difluoromethyl)-1H-1,2,4-triazol-5-one (PubChem CID 54256356) has the molecular formula C3H3F2N3O
and a molecular weight of 135.07 g/mol. Its IUPAC name is 4-(difluoromethyl)-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 4-(difluoromethyl)-1H-1,2,4-triazol-5-one |
| PubChem CID | 54256356 |
| Molecular Formula | C3H3F2N3O |
| Molecular Weight | 135.07 g/mol |
| Exact Mass | 135.02 |
| IUPAC Name | 4-(difluoromethyl)-1H-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]ncn1C(F)F |
| InChI | InChI=1S/C3H3F2N3O/c4-2(5)8-1-6-7-3(8)9/h1-2H,(H,7,9) |
| InChIKey | RAIVXNGMKPJOGT-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.07 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(difluoromethyl)-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(difluoromethyl)-1H-1,2,4-triazol-5-one?
The IUPAC name of 4-(difluoromethyl)-1H-1,2,4-triazol-5-one (CID 54256356) is 4-(difluoromethyl)-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 4-(difluoromethyl)-1H-1,2,4-triazol-5-one?
The canonical SMILES for 4-(difluoromethyl)-1H-1,2,4-triazol-5-one is O=c1[nH]ncn1C(F)F.
What is the InChIKey of 4-(difluoromethyl)-1H-1,2,4-triazol-5-one?
The InChIKey is RAIVXNGMKPJOGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3F2N3O/c4-2(5)8-1-6-7-3(8)9/h1-2H,(H,7,9).
What are the key properties of 4-(difluoromethyl)-1H-1,2,4-triazol-5-one?
4-(difluoromethyl)-1H-1,2,4-triazol-5-one has a molecular weight of 135.07 g/mol, XLogP of -0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(difluoromethyl)-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 54256356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).