C28H40O10 — CID 542566
2,5,8,11,14,20,23,26,29,32-decaoxatricyclo[31.3.1.115,19]octatriaconta-1(37),15(38),16,18,33,35-hexaene (PubChem CID 542566) has the molecular formula C28H40O10 and a molecular weight of 536.62 g/mol. Its IUPAC name is 2,5,8,11,14,20,23,26,29,32-decaoxatricyclo[31.3.1.115,19]octatriaconta-1(37),15(38),16,18,33,35-hexaene.
| Compound Name | 2,5,8,11,14,20,23,26,29,32-decaoxatricyclo[31.3.1.115,19]octatriaconta-1(37),15(38),16,18,33,35-hexaene |
|---|---|
| PubChem CID | 542566 |
| Molecular Formula | C28H40O10 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | 2,5,8,11,14,20,23,26,29,32-decaoxatricyclo[31.3.1.115,19]octatriaconta-1(37),15(38),16,18,33,35-hexaene |
| SMILES | c1cc2cc(c1)OCCOCCOCCOCCOc1cccc(c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C28H40O10/c1-3-25-23-26(4-1)36-20-16-32-12-8-30-10-14-34-18-22-38-28-6-2-5-27(24-28)37-21-17-33-13-9-29-7-11-31-15-19-35-25/h1-6,23-24H,7-22H2 |
| InChIKey | PQGWMOBEFDKNRX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |