C12H14N2 — CID 54256782
di(cyclohexa-1,3-dien-1-yl)diazene (PubChem CID 54256782) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is di(cyclohexa-1,3-dien-1-yl)diazene.
| Compound Name | di(cyclohexa-1,3-dien-1-yl)diazene |
|---|---|
| PubChem CID | 54256782 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | di(cyclohexa-1,3-dien-1-yl)diazene |
| SMILES | C1=CCCC(/N=N/C2=CC=CCC2)=C1 |
| InChI | InChI=1S/C12H14N2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-3,5,7,9H,4,6,8,10H2/b14-13+ |
| InChIKey | RAQAIDUQLXGABM-BUHFOSPRSA-N |
| XLogP | 3.91 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|