About 1-methyl-4-methylidenepiperidine;1,1,1-trifluoroethane
1-methyl-4-methylidenepiperidine;1,1,1-trifluoroethane (PubChem CID 54257027) has the molecular formula C9H16F3N
and a molecular weight of 195.23 g/mol. Its IUPAC name is 1-methyl-4-methylidenepiperidine;1,1,1-trifluoroethane.
Molecular Properties
| Compound Name | 1-methyl-4-methylidenepiperidine;1,1,1-trifluoroethane |
| PubChem CID | 54257027 |
| Molecular Formula | C9H16F3N |
| Molecular Weight | 195.23 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | 1-methyl-4-methylidenepiperidine;1,1,1-trifluoroethane |
| SMILES | C=C1CCN(C)CC1.CC(F)(F)F |
| InChI | InChI=1S/C7H13N.C2H3F3/c1-7-3-5-8(2)6-4-7;1-2(3,4)5/h1,3-6H2,2H3;1H3 |
| InChIKey | RAUJAHRWKNPZDN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.23 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-methylidenepiperidine;1,1,1-trifluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-methylidenepiperidine;1,1,1-trifluoroethane?
The IUPAC name of 1-methyl-4-methylidenepiperidine;1,1,1-trifluoroethane (CID 54257027) is 1-methyl-4-methylidenepiperidine;1,1,1-trifluoroethane.
What is the SMILES notation for 1-methyl-4-methylidenepiperidine;1,1,1-trifluoroethane?
The canonical SMILES for 1-methyl-4-methylidenepiperidine;1,1,1-trifluoroethane is C=C1CCN(C)CC1.CC(F)(F)F.
What is the InChIKey of 1-methyl-4-methylidenepiperidine;1,1,1-trifluoroethane?
The InChIKey is RAUJAHRWKNPZDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.C2H3F3/c1-7-3-5-8(2)6-4-7;1-2(3,4)5/h1,3-6H2,2H3;1H3.
What are the key properties of 1-methyl-4-methylidenepiperidine;1,1,1-trifluoroethane?
1-methyl-4-methylidenepiperidine;1,1,1-trifluoroethane has a molecular weight of 195.23 g/mol, XLogP of 2.84, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-methylidenepiperidine;1,1,1-trifluoroethane is sourced from PubChem (CID 54257027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).