C14H11F6NO — CID 54257427
2-(4-amino-3-methylnaphthalen-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 54257427) has the molecular formula C14H11F6NO and a molecular weight of 323.24 g/mol. Its IUPAC name is 2-(4-amino-3-methylnaphthalen-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(4-amino-3-methylnaphthalen-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 54257427 |
| Molecular Formula | C14H11F6NO |
| Molecular Weight | 323.24 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 2-(4-amino-3-methylnaphthalen-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | Cc1cc(C(O)(C(F)(F)F)C(F)(F)F)c2ccccc2c1N |
| InChI | InChI=1S/C14H11F6NO/c1-7-6-10(8-4-2-3-5-9(8)11(7)21)12(22,13(15,16)17)14(18,19)20/h2-6,22H,21H2,1H3 |
| InChIKey | RBBNKFBXTJBLJZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.24 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|