About 6-bromo-1,1-dimethoxy-3-methylhexa-2,4-diene
6-bromo-1,1-dimethoxy-3-methylhexa-2,4-diene (PubChem CID 54257515) has the molecular formula C9H15BrO2
and a molecular weight of 235.12 g/mol. Its IUPAC name is 6-bromo-1,1-dimethoxy-3-methylhexa-2,4-diene.
Molecular Properties
| Compound Name | 6-bromo-1,1-dimethoxy-3-methylhexa-2,4-diene |
| PubChem CID | 54257515 |
| Molecular Formula | C9H15BrO2 |
| Molecular Weight | 235.12 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 6-bromo-1,1-dimethoxy-3-methylhexa-2,4-diene |
| SMILES | COC(C=C(C)C=CCBr)OC |
| InChI | InChI=1S/C9H15BrO2/c1-8(5-4-6-10)7-9(11-2)12-3/h4-5,7,9H,6H2,1-3H3 |
| InChIKey | RBDCEVVQKUTSMA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.12 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1,1-dimethoxy-3-methylhexa-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1,1-dimethoxy-3-methylhexa-2,4-diene?
The IUPAC name of 6-bromo-1,1-dimethoxy-3-methylhexa-2,4-diene (CID 54257515) is 6-bromo-1,1-dimethoxy-3-methylhexa-2,4-diene.
What is the SMILES notation for 6-bromo-1,1-dimethoxy-3-methylhexa-2,4-diene?
The canonical SMILES for 6-bromo-1,1-dimethoxy-3-methylhexa-2,4-diene is COC(C=C(C)C=CCBr)OC.
What is the InChIKey of 6-bromo-1,1-dimethoxy-3-methylhexa-2,4-diene?
The InChIKey is RBDCEVVQKUTSMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15BrO2/c1-8(5-4-6-10)7-9(11-2)12-3/h4-5,7,9H,6H2,1-3H3.
What are the key properties of 6-bromo-1,1-dimethoxy-3-methylhexa-2,4-diene?
6-bromo-1,1-dimethoxy-3-methylhexa-2,4-diene has a molecular weight of 235.12 g/mol, XLogP of 2.50, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1,1-dimethoxy-3-methylhexa-2,4-diene is sourced from PubChem (CID 54257515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).