C18H18N2O2 — CID 54257606
3-methyl-5-(6,7,8,9-tetrahydrophenazin-2-yl)penta-2,4-dienoic acid (PubChem CID 54257606) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 3-methyl-5-(6,7,8,9-tetrahydrophenazin-2-yl)penta-2,4-dienoic acid.
| Compound Name | 3-methyl-5-(6,7,8,9-tetrahydrophenazin-2-yl)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 54257606 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 3-methyl-5-(6,7,8,9-tetrahydrophenazin-2-yl)penta-2,4-dienoic acid |
| SMILES | CC(C=Cc1ccc2nc3c(nc2c1)CCCC3)=CC(=O)O |
| InChI | InChI=1S/C18H18N2O2/c1-12(10-18(21)22)6-7-13-8-9-16-17(11-13)20-15-5-3-2-4-14(15)19-16/h6-11H,2-5H2,1H3,(H,21,22) |
| InChIKey | RBEMDSUEBRFFAP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|