About 2-aminoethyl 4,5-dimethylthiophene-2-carboxylate
2-aminoethyl 4,5-dimethylthiophene-2-carboxylate (PubChem CID 54257993) has the molecular formula C9H13NO2S
and a molecular weight of 199.27 g/mol. Its IUPAC name is 2-aminoethyl 4,5-dimethylthiophene-2-carboxylate.
Molecular Properties
| Compound Name | 2-aminoethyl 4,5-dimethylthiophene-2-carboxylate |
| PubChem CID | 54257993 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 2-aminoethyl 4,5-dimethylthiophene-2-carboxylate |
| SMILES | Cc1cc(C(=O)OCCN)sc1C |
| InChI | InChI=1S/C9H13NO2S/c1-6-5-8(13-7(6)2)9(11)12-4-3-10/h5H,3-4,10H2,1-2H3 |
| InChIKey | RBKOIPFDZIFUFI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-aminoethyl 4,5-dimethylthiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl 4,5-dimethylthiophene-2-carboxylate?
The IUPAC name of 2-aminoethyl 4,5-dimethylthiophene-2-carboxylate (CID 54257993) is 2-aminoethyl 4,5-dimethylthiophene-2-carboxylate.
What is the SMILES notation for 2-aminoethyl 4,5-dimethylthiophene-2-carboxylate?
The canonical SMILES for 2-aminoethyl 4,5-dimethylthiophene-2-carboxylate is Cc1cc(C(=O)OCCN)sc1C.
What is the InChIKey of 2-aminoethyl 4,5-dimethylthiophene-2-carboxylate?
The InChIKey is RBKOIPFDZIFUFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S/c1-6-5-8(13-7(6)2)9(11)12-4-3-10/h5H,3-4,10H2,1-2H3.
What are the key properties of 2-aminoethyl 4,5-dimethylthiophene-2-carboxylate?
2-aminoethyl 4,5-dimethylthiophene-2-carboxylate has a molecular weight of 199.27 g/mol, XLogP of 1.48, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl 4,5-dimethylthiophene-2-carboxylate is sourced from PubChem (CID 54257993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).