C19H26FN3O3 — CID 54258020
(2-fluorophenyl) 2-[(4-piperidin-1-ylpiperidine-1-carbonyl)amino]acetate (PubChem CID 54258020) has the molecular formula C19H26FN3O3 and a molecular weight of 363.43 g/mol. Its IUPAC name is (2-fluorophenyl) 2-[(4-piperidin-1-ylpiperidine-1-carbonyl)amino]acetate.
| Compound Name | (2-fluorophenyl) 2-[(4-piperidin-1-ylpiperidine-1-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 54258020 |
| Molecular Formula | C19H26FN3O3 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | (2-fluorophenyl) 2-[(4-piperidin-1-ylpiperidine-1-carbonyl)amino]acetate |
| SMILES | O=C(CNC(=O)N1CCC(N2CCCCC2)CC1)Oc1ccccc1F |
| InChI | InChI=1S/C19H26FN3O3/c20-16-6-2-3-7-17(16)26-18(24)14-21-19(25)23-12-8-15(9-13-23)22-10-4-1-5-11-22/h2-3,6-7,15H,1,4-5,8-14H2,(H,21,25) |
| InChIKey | RBKZTZPGVHMSSA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|