About 3,4-dihydroxybenzaldehyde;ethane
3,4-dihydroxybenzaldehyde;ethane (PubChem CID 54258106) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 3,4-dihydroxybenzaldehyde;ethane.
Molecular Properties
| Compound Name | 3,4-dihydroxybenzaldehyde;ethane |
| PubChem CID | 54258106 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 3,4-dihydroxybenzaldehyde;ethane |
| SMILES | CC.O=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C7H6O3.C2H6/c8-4-5-1-2-6(9)7(10)3-5;1-2/h1-4,9-10H;1-2H3 |
| InChIKey | RBMORNLKJQMUQW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydroxybenzaldehyde;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydroxybenzaldehyde;ethane?
The IUPAC name of 3,4-dihydroxybenzaldehyde;ethane (CID 54258106) is 3,4-dihydroxybenzaldehyde;ethane.
What is the SMILES notation for 3,4-dihydroxybenzaldehyde;ethane?
The canonical SMILES for 3,4-dihydroxybenzaldehyde;ethane is CC.O=Cc1ccc(O)c(O)c1.
What is the InChIKey of 3,4-dihydroxybenzaldehyde;ethane?
The InChIKey is RBMORNLKJQMUQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.C2H6/c8-4-5-1-2-6(9)7(10)3-5;1-2/h1-4,9-10H;1-2H3.
What are the key properties of 3,4-dihydroxybenzaldehyde;ethane?
3,4-dihydroxybenzaldehyde;ethane has a molecular weight of 168.19 g/mol, XLogP of 1.94, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroxybenzaldehyde;ethane is sourced from PubChem (CID 54258106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).