C20H32O5 — CID 54258110
5-(trioxidanyl)icosa-6,8,11,14-tetraenoic acid (PubChem CID 54258110) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is 5-(trioxidanyl)icosa-6,8,11,14-tetraenoic acid.
| Compound Name | 5-(trioxidanyl)icosa-6,8,11,14-tetraenoic acid |
|---|---|
| PubChem CID | 54258110 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 5-(trioxidanyl)icosa-6,8,11,14-tetraenoic acid |
| SMILES | CCCCCC=CCC=CCC=CC=CC(CCCC(=O)O)OOO |
| InChI | InChI=1S/C20H32O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-16-19(24-25-23)17-15-18-20(21)22/h6-7,9-10,12-14,16,19,23H,2-5,8,11,15,17-18H2,1H3,(H,21,22) |
| InChIKey | RBMQGCZMORRVAV-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|