C25H44 — CID 54258927
pent-1-ene;(3S,5R)-1,2,3,4-tetramethyl-5-[2-[(1R,4S)-2,3,4,5-tetramethylcyclopent-2-en-1-yl]ethyl]cyclopentene (PubChem CID 54258927) has the molecular formula C25H44 and a molecular weight of 344.63 g/mol. Its IUPAC name is pent-1-ene;(3S,5R)-1,2,3,4-tetramethyl-5-[2-[(1R,4S)-2,3,4,5-tetramethylcyclopent-2-en-1-yl]ethyl]cyclopentene.
| Compound Name | pent-1-ene;(3S,5R)-1,2,3,4-tetramethyl-5-[2-[(1R,4S)-2,3,4,5-tetramethylcyclopent-2-en-1-yl]ethyl]cyclopentene |
|---|---|
| PubChem CID | 54258927 |
| Molecular Formula | C25H44 |
| Molecular Weight | 344.63 g/mol |
| Exact Mass | 344.34 |
| IUPAC Name | pent-1-ene;(3S,5R)-1,2,3,4-tetramethyl-5-[2-[(1R,4S)-2,3,4,5-tetramethylcyclopent-2-en-1-yl]ethyl]cyclopentene |
| SMILES | C=CCCC.CC1=C(C)[C@H](CC[C@H]2C(C)=C(C)[C@@H](C)C2C)C(C)[C@@H]1C |
| InChI | InChI=1S/C20H34.C5H10/c1-11-12(2)16(6)19(15(11)5)9-10-20-17(7)13(3)14(4)18(20)8;1-3-5-4-2/h11,13,15,17,19-20H,9-10H2,1-8H3;3H,1,4-5H2,2H3/t11-,13-,15?,17?,19-,20-;/m1./s1 |
| InChIKey | RCBWMFOIQHGEOW-ZECWCPESSA-N |
| XLogP | 8.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.63 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|