About ethyl 3-[[2-(3,4-dichlorophenyl)ethanethioyl]amino]but-2-enoate
ethyl 3-[[2-(3,4-dichlorophenyl)ethanethioyl]amino]but-2-enoate (PubChem CID 54259163) has the molecular formula C14H15Cl2NO2S
and a molecular weight of 332.25 g/mol. Its IUPAC name is ethyl 3-[[2-(3,4-dichlorophenyl)ethanethioyl]amino]but-2-enoate.
Molecular Properties
| Compound Name | ethyl 3-[[2-(3,4-dichlorophenyl)ethanethioyl]amino]but-2-enoate |
| PubChem CID | 54259163 |
| Molecular Formula | C14H15Cl2NO2S |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | ethyl 3-[[2-(3,4-dichlorophenyl)ethanethioyl]amino]but-2-enoate |
| SMILES | CCOC(=O)C=C(C)NC(=S)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H15Cl2NO2S/c1-3-19-14(18)6-9(2)17-13(20)8-10-4-5-11(15)12(16)7-10/h4-7H,3,8H2,1-2H3,(H,17,20) |
| InChIKey | RCGCFAIXWAZSKY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[[2-(3,4-dichlorophenyl)ethanethioyl]amino]but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[[2-(3,4-dichlorophenyl)ethanethioyl]amino]but-2-enoate?
The IUPAC name of ethyl 3-[[2-(3,4-dichlorophenyl)ethanethioyl]amino]but-2-enoate (CID 54259163) is ethyl 3-[[2-(3,4-dichlorophenyl)ethanethioyl]amino]but-2-enoate.
What is the SMILES notation for ethyl 3-[[2-(3,4-dichlorophenyl)ethanethioyl]amino]but-2-enoate?
The canonical SMILES for ethyl 3-[[2-(3,4-dichlorophenyl)ethanethioyl]amino]but-2-enoate is CCOC(=O)C=C(C)NC(=S)Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of ethyl 3-[[2-(3,4-dichlorophenyl)ethanethioyl]amino]but-2-enoate?
The InChIKey is RCGCFAIXWAZSKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2NO2S/c1-3-19-14(18)6-9(2)17-13(20)8-10-4-5-11(15)12(16)7-10/h4-7H,3,8H2,1-2H3,(H,17,20).
What are the key properties of ethyl 3-[[2-(3,4-dichlorophenyl)ethanethioyl]amino]but-2-enoate?
ethyl 3-[[2-(3,4-dichlorophenyl)ethanethioyl]amino]but-2-enoate has a molecular weight of 332.25 g/mol, XLogP of 3.92, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[[2-(3,4-dichlorophenyl)ethanethioyl]amino]but-2-enoate is sourced from PubChem (CID 54259163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).