About 3,5-bis(2-methoxyethyl)-1,2,4-triazol-4-amine
3,5-bis(2-methoxyethyl)-1,2,4-triazol-4-amine (PubChem CID 542599) has the molecular formula C8H16N4O2
and a molecular weight of 200.24 g/mol. Its IUPAC name is 3,5-bis(2-methoxyethyl)-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | 3,5-bis(2-methoxyethyl)-1,2,4-triazol-4-amine |
| PubChem CID | 542599 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 3,5-bis(2-methoxyethyl)-1,2,4-triazol-4-amine |
| SMILES | COCCc1nnc(CCOC)n1N |
| InChI | InChI=1S/C8H16N4O2/c1-13-5-3-7-10-11-8(12(7)9)4-6-14-2/h3-6,9H2,1-2H3 |
| InChIKey | WLYLBTIHKVYGBD-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3,5-bis(2-methoxyethyl)-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(2-methoxyethyl)-1,2,4-triazol-4-amine?
The IUPAC name of 3,5-bis(2-methoxyethyl)-1,2,4-triazol-4-amine (CID 542599) is 3,5-bis(2-methoxyethyl)-1,2,4-triazol-4-amine.
What is the SMILES notation for 3,5-bis(2-methoxyethyl)-1,2,4-triazol-4-amine?
The canonical SMILES for 3,5-bis(2-methoxyethyl)-1,2,4-triazol-4-amine is COCCc1nnc(CCOC)n1N.
What is the InChIKey of 3,5-bis(2-methoxyethyl)-1,2,4-triazol-4-amine?
The InChIKey is WLYLBTIHKVYGBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N4O2/c1-13-5-3-7-10-11-8(12(7)9)4-6-14-2/h3-6,9H2,1-2H3.
What are the key properties of 3,5-bis(2-methoxyethyl)-1,2,4-triazol-4-amine?
3,5-bis(2-methoxyethyl)-1,2,4-triazol-4-amine has a molecular weight of 200.24 g/mol, XLogP of -0.63, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(2-methoxyethyl)-1,2,4-triazol-4-amine is sourced from PubChem (CID 542599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).