C24H19ClF5NO3 — CID 54259915
cis-[cyano-(3-phenoxyphenyl)methyl] (1R,3S)-3-(2-chloro-3,3,4,4,4-pentafluorobut-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 54259915) has the molecular formula C24H19ClF5NO3 and a molecular weight of 499.86 g/mol. Its IUPAC name is cis-[cyano-(3-phenoxyphenyl)methyl] (1R,3S)-3-(2-chloro-3,3,4,4,4-pentafluorobut-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | cis-[cyano-(3-phenoxyphenyl)methyl] (1R,3S)-3-(2-chloro-3,3,4,4,4-pentafluorobut-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54259915 |
| Molecular Formula | C24H19ClF5NO3 |
| Molecular Weight | 499.86 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | cis-[cyano-(3-phenoxyphenyl)methyl] (1R,3S)-3-(2-chloro-3,3,4,4,4-pentafluorobut-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@H](C=C(Cl)C(F)(F)C(F)(F)F)[C@H]1C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C24H19ClF5NO3/c1-22(2)17(12-19(25)23(26,27)24(28,29)30)20(22)21(32)34-18(13-31)14-7-6-10-16(11-14)33-15-8-4-3-5-9-15/h3-12,17-18,20H,1-2H3/t17-,18?,20+/m1/s1 |
| InChIKey | RCTSNOZOSMPMGH-IKCNDWCXSA-N |
| XLogP | 7.18 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.86 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|