About 4,4-dimethyl-6-(2-phenylprop-1-enyl)-2,3-dihydrothiochromene
4,4-dimethyl-6-(2-phenylprop-1-enyl)-2,3-dihydrothiochromene (PubChem CID 54260613) has the molecular formula C20H22S
and a molecular weight of 294.46 g/mol. Its IUPAC name is 4,4-dimethyl-6-(2-phenylprop-1-enyl)-2,3-dihydrothiochromene.
Molecular Properties
| Compound Name | 4,4-dimethyl-6-(2-phenylprop-1-enyl)-2,3-dihydrothiochromene |
| PubChem CID | 54260613 |
| Molecular Formula | C20H22S |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 4,4-dimethyl-6-(2-phenylprop-1-enyl)-2,3-dihydrothiochromene |
| SMILES | CC(=Cc1ccc2c(c1)C(C)(C)CCS2)c1ccccc1 |
| InChI | InChI=1S/C20H22S/c1-15(17-7-5-4-6-8-17)13-16-9-10-19-18(14-16)20(2,3)11-12-21-19/h4-10,13-14H,11-12H2,1-3H3 |
| InChIKey | RDFXSYSWPGNGMK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dimethyl-6-(2-phenylprop-1-enyl)-2,3-dihydrothiochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-6-(2-phenylprop-1-enyl)-2,3-dihydrothiochromene?
The IUPAC name of 4,4-dimethyl-6-(2-phenylprop-1-enyl)-2,3-dihydrothiochromene (CID 54260613) is 4,4-dimethyl-6-(2-phenylprop-1-enyl)-2,3-dihydrothiochromene.
What is the SMILES notation for 4,4-dimethyl-6-(2-phenylprop-1-enyl)-2,3-dihydrothiochromene?
The canonical SMILES for 4,4-dimethyl-6-(2-phenylprop-1-enyl)-2,3-dihydrothiochromene is CC(=Cc1ccc2c(c1)C(C)(C)CCS2)c1ccccc1.
What is the InChIKey of 4,4-dimethyl-6-(2-phenylprop-1-enyl)-2,3-dihydrothiochromene?
The InChIKey is RDFXSYSWPGNGMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22S/c1-15(17-7-5-4-6-8-17)13-16-9-10-19-18(14-16)20(2,3)11-12-21-19/h4-10,13-14H,11-12H2,1-3H3.
What are the key properties of 4,4-dimethyl-6-(2-phenylprop-1-enyl)-2,3-dihydrothiochromene?
4,4-dimethyl-6-(2-phenylprop-1-enyl)-2,3-dihydrothiochromene has a molecular weight of 294.46 g/mol, XLogP of 6.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-6-(2-phenylprop-1-enyl)-2,3-dihydrothiochromene is sourced from PubChem (CID 54260613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).