C31H44ClN9O2S2 — CID 54260712
N'-[7-[[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]-methylamino]heptyl]-N-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-nitroethanimidamide (PubChem CID 54260712) has the molecular formula C31H44ClN9O2S2 and a molecular weight of 674.34 g/mol. Its IUPAC name is N'-[7-[[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]-methylamino]heptyl]-N-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-nitroethanimidamide.
| Compound Name | N'-[7-[[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]-methylamino]heptyl]-N-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-nitroethanimidamide |
|---|---|
| PubChem CID | 54260712 |
| Molecular Formula | C31H44ClN9O2S2 |
| Molecular Weight | 674.34 g/mol |
| Exact Mass | 673.27 |
| IUPAC Name | N'-[7-[[3-(4-chlorophenyl)-3-pyridin-2-ylpropyl]-methylamino]heptyl]-N-[2-[[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-nitroethanimidamide |
| SMILES | CN(CCCCCCC/N=C(\C[N+](=O)[O-])NCCSCc1csc(N=C(N)N)n1)CCC(c1ccc(Cl)cc1)c1ccccn1 |
| InChI | InChI=1S/C31H44ClN9O2S2/c1-40(19-14-27(28-9-5-7-15-35-28)24-10-12-25(32)13-11-24)18-8-4-2-3-6-16-36-29(21-41(42)43)37-17-20-44-22-26-23-45-31(38-26)39-30(33)34/h5,7,9-13,15,23,27H,2-4,6,8,14,16-22H2,1H3,(H,36,37)(H4,33,34,38,39) |
| InChIKey | RDHNNWBZXQASGT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 160.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.34 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|