C18H17NO — CID 54261147
N-(5,10-dimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)formamide (PubChem CID 54261147) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is N-(5,10-dimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)formamide.
| Compound Name | N-(5,10-dimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)formamide |
|---|---|
| PubChem CID | 54261147 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(5,10-dimethyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenyl)formamide |
| SMILES | CC1=Cc2ccc(C)cc2C(NC=O)c2ccccc21 |
| InChI | InChI=1S/C18H17NO/c1-12-7-8-14-10-13(2)15-5-3-4-6-16(15)18(19-11-20)17(14)9-12/h3-11,18H,1-2H3,(H,19,20) |
| InChIKey | RDPDBRJUUZTGHK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|