C27H41FO5S — CID 54261847
methyl 2-[(4-fluorophenyl)methyl]-7-[(1S,2R)-3-hydroxy-2-(2-hydroxyheptylsulfanyl)-5-oxocyclopentyl]heptanoate (PubChem CID 54261847) has the molecular formula C27H41FO5S and a molecular weight of 496.69 g/mol. Its IUPAC name is methyl 2-[(4-fluorophenyl)methyl]-7-[(1S,2R)-3-hydroxy-2-(2-hydroxyheptylsulfanyl)-5-oxocyclopentyl]heptanoate.
| Compound Name | methyl 2-[(4-fluorophenyl)methyl]-7-[(1S,2R)-3-hydroxy-2-(2-hydroxyheptylsulfanyl)-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 54261847 |
| Molecular Formula | C27H41FO5S |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | methyl 2-[(4-fluorophenyl)methyl]-7-[(1S,2R)-3-hydroxy-2-(2-hydroxyheptylsulfanyl)-5-oxocyclopentyl]heptanoate |
| SMILES | CCCCCC(O)CS[C@H]1C(O)CC(=O)[C@@H]1CCCCCC(Cc1ccc(F)cc1)C(=O)OC |
| InChI | InChI=1S/C27H41FO5S/c1-3-4-6-10-22(29)18-34-26-23(24(30)17-25(26)31)11-8-5-7-9-20(27(32)33-2)16-19-12-14-21(28)15-13-19/h12-15,20,22-23,25-26,29,31H,3-11,16-18H2,1-2H3/t20?,22?,23-,25?,26+/m0/s1 |
| InChIKey | REBPGCPUPMBCHE-VPZRFOKMSA-N |
| XLogP | 5.10 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|