C11H16N2O — CID 54262252
bis(2,3,4,5-tetrahydropyridin-3-yl)methanone (PubChem CID 54262252) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is bis(2,3,4,5-tetrahydropyridin-3-yl)methanone.
| Compound Name | bis(2,3,4,5-tetrahydropyridin-3-yl)methanone |
|---|---|
| PubChem CID | 54262252 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | bis(2,3,4,5-tetrahydropyridin-3-yl)methanone |
| SMILES | O=C(C1CCC=NC1)C1CCC=NC1 |
| InChI | InChI=1S/C11H16N2O/c14-11(9-3-1-5-12-7-9)10-4-2-6-13-8-10/h5-6,9-10H,1-4,7-8H2 |
| InChIKey | REIAEEFTTWTARS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |