C40H58N4O8S — CID 54262737
2-[(4-methylbenzoyl)amino]ethanesulfonate;2-(4-methylpiperazin-1-yl)ethyl 4-methylbenzoate;trimethyl-[2-(4-methylbenzoyl)oxybutyl]azanium (PubChem CID 54262737) has the molecular formula C40H58N4O8S and a molecular weight of 754.99 g/mol. Its IUPAC name is 2-[(4-methylbenzoyl)amino]ethanesulfonate;2-(4-methylpiperazin-1-yl)ethyl 4-methylbenzoate;trimethyl-[2-(4-methylbenzoyl)oxybutyl]azanium.
| Compound Name | 2-[(4-methylbenzoyl)amino]ethanesulfonate;2-(4-methylpiperazin-1-yl)ethyl 4-methylbenzoate;trimethyl-[2-(4-methylbenzoyl)oxybutyl]azanium |
|---|---|
| PubChem CID | 54262737 |
| Molecular Formula | C40H58N4O8S |
| Molecular Weight | 754.99 g/mol |
| Exact Mass | 754.40 |
| IUPAC Name | 2-[(4-methylbenzoyl)amino]ethanesulfonate;2-(4-methylpiperazin-1-yl)ethyl 4-methylbenzoate;trimethyl-[2-(4-methylbenzoyl)oxybutyl]azanium |
| SMILES | CCC(C[N+](C)(C)C)OC(=O)c1ccc(C)cc1.Cc1ccc(C(=O)NCCS(=O)(=O)[O-])cc1.Cc1ccc(C(=O)OCCN2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C15H22N2O2.C15H24NO2.C10H13NO4S/c1-13-3-5-14(6-4-13)15(18)19-12-11-17-9-7-16(2)8-10-17;1-6-14(11-16(3,4)5)18-15(17)13-9-7-12(2)8-10-13;1-8-2-4-9(5-3-8)10(12)11-6-7-16(13,14)15/h3-6H,7-12H2,1-2H3;7-10,14H,6,11H2,1-5H3;2-5H,6-7H2,1H3,(H,11,12)(H,13,14,15)/q;+1;/p-1 |
| InChIKey | REQMIBOKCPEIAK-UHFFFAOYSA-M |
| XLogP | 4.31 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.99 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|