About 13-azatetracyclo[8.2.1.02,9.04,7]tridecane
13-azatetracyclo[8.2.1.02,9.04,7]tridecane (PubChem CID 54262789) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 13-azatetracyclo[8.2.1.02,9.04,7]tridecane.
Molecular Properties
| Compound Name | 13-azatetracyclo[8.2.1.02,9.04,7]tridecane |
| PubChem CID | 54262789 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 13-azatetracyclo[8.2.1.02,9.04,7]tridecane |
| SMILES | C1CC2CC3C4CCC(N4)C3CC12 |
| InChI | InChI=1S/C12H19N/c1-2-8-6-10-9(5-7(1)8)11-3-4-12(10)13-11/h7-13H,1-6H2 |
| InChIKey | SZTHNVUDRUMZPP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 13-azatetracyclo[8.2.1.02,9.04,7]tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 13-azatetracyclo[8.2.1.02,9.04,7]tridecane?
The IUPAC name of 13-azatetracyclo[8.2.1.02,9.04,7]tridecane (CID 54262789) is 13-azatetracyclo[8.2.1.02,9.04,7]tridecane.
What is the SMILES notation for 13-azatetracyclo[8.2.1.02,9.04,7]tridecane?
The canonical SMILES for 13-azatetracyclo[8.2.1.02,9.04,7]tridecane is C1CC2CC3C4CCC(N4)C3CC12.
What is the InChIKey of 13-azatetracyclo[8.2.1.02,9.04,7]tridecane?
The InChIKey is SZTHNVUDRUMZPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N/c1-2-8-6-10-9(5-7(1)8)11-3-4-12(10)13-11/h7-13H,1-6H2.
What are the key properties of 13-azatetracyclo[8.2.1.02,9.04,7]tridecane?
13-azatetracyclo[8.2.1.02,9.04,7]tridecane has a molecular weight of 177.29 g/mol, XLogP of 2.17, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 13-azatetracyclo[8.2.1.02,9.04,7]tridecane is sourced from PubChem (CID 54262789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).