About 1,5-diamino-2,4-didiazopentan-3-one
1,5-diamino-2,4-didiazopentan-3-one (PubChem CID 54262980) has the molecular formula C5H8N6O
and a molecular weight of 168.16 g/mol. Its IUPAC name is 1,5-diamino-2,4-didiazopentan-3-one.
Molecular Properties
| Compound Name | 1,5-diamino-2,4-didiazopentan-3-one |
| PubChem CID | 54262980 |
| Molecular Formula | C5H8N6O |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 1,5-diamino-2,4-didiazopentan-3-one |
| SMILES | [N-]=[N+]=C(CN)C(=O)C(CN)=[N+]=[N-] |
| InChI | InChI=1S/C5H8N6O/c6-1-3(10-8)5(12)4(2-7)11-9/h1-2,6-7H2 |
| InChIKey | REUOGMJOLFLAAN-UHFFFAOYSA-N |
| XLogP | -2.19 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1,5-diamino-2,4-didiazopentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-diamino-2,4-didiazopentan-3-one?
The IUPAC name of 1,5-diamino-2,4-didiazopentan-3-one (CID 54262980) is 1,5-diamino-2,4-didiazopentan-3-one.
What is the SMILES notation for 1,5-diamino-2,4-didiazopentan-3-one?
The canonical SMILES for 1,5-diamino-2,4-didiazopentan-3-one is [N-]=[N+]=C(CN)C(=O)C(CN)=[N+]=[N-].
What is the InChIKey of 1,5-diamino-2,4-didiazopentan-3-one?
The InChIKey is REUOGMJOLFLAAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N6O/c6-1-3(10-8)5(12)4(2-7)11-9/h1-2,6-7H2.
What are the key properties of 1,5-diamino-2,4-didiazopentan-3-one?
1,5-diamino-2,4-didiazopentan-3-one has a molecular weight of 168.16 g/mol, XLogP of -2.19, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-diamino-2,4-didiazopentan-3-one is sourced from PubChem (CID 54262980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).