C19H18ClF7O4S — CID 54263503
trans-[4-(ethylsulfonylmethyl)-2,3,5,6-tetrafluorophenyl]methyl (1R,3R)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 54263503) has the molecular formula C19H18ClF7O4S and a molecular weight of 510.86 g/mol. Its IUPAC name is trans-[4-(ethylsulfonylmethyl)-2,3,5,6-tetrafluorophenyl]methyl (1R,3R)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | trans-[4-(ethylsulfonylmethyl)-2,3,5,6-tetrafluorophenyl]methyl (1R,3R)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54263503 |
| Molecular Formula | C19H18ClF7O4S |
| Molecular Weight | 510.86 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | trans-[4-(ethylsulfonylmethyl)-2,3,5,6-tetrafluorophenyl]methyl (1R,3R)-3-(2-chloro-3,3,3-trifluoroprop-1-enyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | CCS(=O)(=O)Cc1c(F)c(F)c(COC(=O)[C@@H]2[C@H](C=C(Cl)C(F)(F)F)C2(C)C)c(F)c1F |
| InChI | InChI=1S/C19H18ClF7O4S/c1-4-32(29,30)7-9-15(23)13(21)8(14(22)16(9)24)6-31-17(28)12-10(18(12,2)3)5-11(20)19(25,26)27/h5,10,12H,4,6-7H2,1-3H3/t10-,12-/m0/s1 |
| InChIKey | RFDDJSXWLJJODY-JQWIXIFHSA-N |
| XLogP | 5.18 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.86 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|