C24H48N2 — CID 54263791
1-(3,7,11,15-tetramethylhexadec-2-enyl)piperazine (PubChem CID 54263791) has the molecular formula C24H48N2 and a molecular weight of 364.66 g/mol. Its IUPAC name is 1-(3,7,11,15-tetramethylhexadec-2-enyl)piperazine.
| Compound Name | 1-(3,7,11,15-tetramethylhexadec-2-enyl)piperazine |
|---|---|
| PubChem CID | 54263791 |
| Molecular Formula | C24H48N2 |
| Molecular Weight | 364.66 g/mol |
| Exact Mass | 364.38 |
| IUPAC Name | 1-(3,7,11,15-tetramethylhexadec-2-enyl)piperazine |
| SMILES | CC(=CCN1CCNCC1)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C24H48N2/c1-21(2)9-6-10-22(3)11-7-12-23(4)13-8-14-24(5)15-18-26-19-16-25-17-20-26/h15,21-23,25H,6-14,16-20H2,1-5H3 |
| InChIKey | RFIOHNFNKURRAZ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.66 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|