About 4-methoxycyclohexa-1,3-diene-1-carbaldehyde
4-methoxycyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 54263815) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is 4-methoxycyclohexa-1,3-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | 4-methoxycyclohexa-1,3-diene-1-carbaldehyde |
| PubChem CID | 54263815 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 4-methoxycyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | COC1=CC=C(C=O)CC1 |
| InChI | InChI=1S/C8H10O2/c1-10-8-4-2-7(6-9)3-5-8/h2,4,6H,3,5H2,1H3 |
| InChIKey | LCHMLNTWDGOUNG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxycyclohexa-1,3-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxycyclohexa-1,3-diene-1-carbaldehyde?
The IUPAC name of 4-methoxycyclohexa-1,3-diene-1-carbaldehyde (CID 54263815) is 4-methoxycyclohexa-1,3-diene-1-carbaldehyde.
What is the SMILES notation for 4-methoxycyclohexa-1,3-diene-1-carbaldehyde?
The canonical SMILES for 4-methoxycyclohexa-1,3-diene-1-carbaldehyde is COC1=CC=C(C=O)CC1.
What is the InChIKey of 4-methoxycyclohexa-1,3-diene-1-carbaldehyde?
The InChIKey is LCHMLNTWDGOUNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2/c1-10-8-4-2-7(6-9)3-5-8/h2,4,6H,3,5H2,1H3.
What are the key properties of 4-methoxycyclohexa-1,3-diene-1-carbaldehyde?
4-methoxycyclohexa-1,3-diene-1-carbaldehyde has a molecular weight of 138.17 g/mol, XLogP of 1.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxycyclohexa-1,3-diene-1-carbaldehyde is sourced from PubChem (CID 54263815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).