C16H23NO4 — CID 54264930
(1S,2R,5S,8R)-5-(phenylmethoxymethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,8-triol (PubChem CID 54264930) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is (1S,2R,5S,8R)-5-(phenylmethoxymethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,8-triol.
| Compound Name | (1S,2R,5S,8R)-5-(phenylmethoxymethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,8-triol |
|---|---|
| PubChem CID | 54264930 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | (1S,2R,5S,8R)-5-(phenylmethoxymethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine-1,2,8-triol |
| SMILES | O[C@@H]1CC[C@@H](COCc2ccccc2)N2C[C@@H](O)[C@@H](O)C12 |
| InChI | InChI=1S/C16H23NO4/c18-13-7-6-12(17-8-14(19)16(20)15(13)17)10-21-9-11-4-2-1-3-5-11/h1-5,12-16,18-20H,6-10H2/t12-,13+,14+,15?,16+/m0/s1 |
| InChIKey | RGCDHVPMXKVYRV-QCFNQLOMSA-N |
| XLogP | 0.13 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |