C23H43IOSi — CID 54265632
tert-butyl-(1-iodo-5,9,13-trimethyltetradeca-4,8,12-trien-3-yl)oxy-dimethylsilane (PubChem CID 54265632) has the molecular formula C23H43IOSi and a molecular weight of 490.59 g/mol. Its IUPAC name is tert-butyl-(1-iodo-5,9,13-trimethyltetradeca-4,8,12-trien-3-yl)oxy-dimethylsilane.
| Compound Name | tert-butyl-(1-iodo-5,9,13-trimethyltetradeca-4,8,12-trien-3-yl)oxy-dimethylsilane |
|---|---|
| PubChem CID | 54265632 |
| Molecular Formula | C23H43IOSi |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | tert-butyl-(1-iodo-5,9,13-trimethyltetradeca-4,8,12-trien-3-yl)oxy-dimethylsilane |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC(CCI)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H43IOSi/c1-19(2)12-10-13-20(3)14-11-15-21(4)18-22(16-17-24)25-26(8,9)23(5,6)7/h12,14,18,22H,10-11,13,15-17H2,1-9H3 |
| InChIKey | RGOIEXKUPYJLRO-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|