C34H33F4O5S- — CID 54265664
2,3,5,6-tetrafluoro-4-[(4-methylphenyl)-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]benzenesulfonate (PubChem CID 54265664) has the molecular formula C34H33F4O5S- and a molecular weight of 629.69 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[(4-methylphenyl)-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]benzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-[(4-methylphenyl)-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]benzenesulfonate |
|---|---|
| PubChem CID | 54265664 |
| Molecular Formula | C34H33F4O5S- |
| Molecular Weight | 629.69 g/mol |
| Exact Mass | 629.20 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[(4-methylphenyl)-bis[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]benzenesulfonate |
| SMILES | Cc1ccc(C(c2ccc(OC(C)(C)C)cc2)(c2ccc(OC(C)(C)C)cc2)c2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)cc1 |
| InChI | InChI=1S/C34H34F4O5S/c1-20-8-10-21(11-9-20)34(22-12-16-24(17-13-22)42-32(2,3)4,23-14-18-25(19-15-23)43-33(5,6)7)26-27(35)29(37)31(44(39,40)41)30(38)28(26)36/h8-19H,1-7H3,(H,39,40,41)/p-1 |
| InChIKey | RGOSZQRRNRDQLU-UHFFFAOYSA-M |
| XLogP | 8.19 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.69 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|