C8H12N2OS2 — CID 54265783
1,3-oxazol-2-yl N,N-diethylcarbamodithioate (PubChem CID 54265783) has the molecular formula C8H12N2OS2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1,3-oxazol-2-yl N,N-diethylcarbamodithioate.
| Compound Name | 1,3-oxazol-2-yl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 54265783 |
| Molecular Formula | C8H12N2OS2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 1,3-oxazol-2-yl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)Sc1ncco1 |
| InChI | InChI=1S/C8H12N2OS2/c1-3-10(4-2)8(12)13-7-9-5-6-11-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | RGQPNVGJQCGRCZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|