About 1,3-oxazol-2-yl N,N-diethylcarbamodithioate
1,3-oxazol-2-yl N,N-diethylcarbamodithioate (PubChem CID 54265783) has the molecular formula C8H12N2OS2
and a molecular weight of 216.33 g/mol. Its IUPAC name is 1,3-oxazol-2-yl N,N-diethylcarbamodithioate.
Molecular Properties
| Compound Name | 1,3-oxazol-2-yl N,N-diethylcarbamodithioate |
| PubChem CID | 54265783 |
| Molecular Formula | C8H12N2OS2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 1,3-oxazol-2-yl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)Sc1ncco1 |
| InChI | InChI=1S/C8H12N2OS2/c1-3-10(4-2)8(12)13-7-9-5-6-11-7/h5-6H,3-4H2,1-2H3 |
| InChIKey | RGQPNVGJQCGRCZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-oxazol-2-yl N,N-diethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-oxazol-2-yl N,N-diethylcarbamodithioate?
The IUPAC name of 1,3-oxazol-2-yl N,N-diethylcarbamodithioate (CID 54265783) is 1,3-oxazol-2-yl N,N-diethylcarbamodithioate.
What is the SMILES notation for 1,3-oxazol-2-yl N,N-diethylcarbamodithioate?
The canonical SMILES for 1,3-oxazol-2-yl N,N-diethylcarbamodithioate is CCN(CC)C(=S)Sc1ncco1.
What is the InChIKey of 1,3-oxazol-2-yl N,N-diethylcarbamodithioate?
The InChIKey is RGQPNVGJQCGRCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2OS2/c1-3-10(4-2)8(12)13-7-9-5-6-11-7/h5-6H,3-4H2,1-2H3.
What are the key properties of 1,3-oxazol-2-yl N,N-diethylcarbamodithioate?
1,3-oxazol-2-yl N,N-diethylcarbamodithioate has a molecular weight of 216.33 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-oxazol-2-yl N,N-diethylcarbamodithioate is sourced from PubChem (CID 54265783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).