C28H34N2O3S — CID 54265997
2-[(2R)-3-hydroxy-4-[(3R)-3-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-phenylsulfanylbutan-2-yl]isoindole-1,3-dione (PubChem CID 54265997) has the molecular formula C28H34N2O3S and a molecular weight of 478.66 g/mol. Its IUPAC name is 2-[(2R)-3-hydroxy-4-[(3R)-3-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-phenylsulfanylbutan-2-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R)-3-hydroxy-4-[(3R)-3-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-phenylsulfanylbutan-2-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 54265997 |
| Molecular Formula | C28H34N2O3S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | 2-[(2R)-3-hydroxy-4-[(3R)-3-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-1-phenylsulfanylbutan-2-yl]isoindole-1,3-dione |
| SMILES | C[C@@H]1CC2CCCCC2CN1CC(O)[C@H](CSc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H34N2O3S/c1-19-15-20-9-5-6-10-21(20)16-29(19)17-26(31)25(18-34-22-11-3-2-4-12-22)30-27(32)23-13-7-8-14-24(23)28(30)33/h2-4,7-8,11-14,19-21,25-26,31H,5-6,9-10,15-18H2,1H3/t19-,20?,21?,25+,26?/m1/s1 |
| InChIKey | RGURZVCTSJJWQR-ATNRYLQVSA-N |
| XLogP | 4.70 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|