About 3-propan-2-yloxypropyl formate
3-propan-2-yloxypropyl formate (PubChem CID 54266056) has the molecular formula C7H14O3
and a molecular weight of 146.19 g/mol. Its IUPAC name is 3-propan-2-yloxypropyl formate.
Molecular Properties
| Compound Name | 3-propan-2-yloxypropyl formate |
| PubChem CID | 54266056 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 3-propan-2-yloxypropyl formate |
| SMILES | CC(C)OCCCOC=O |
| InChI | InChI=1S/C7H14O3/c1-7(2)10-5-3-4-9-6-8/h6-7H,3-5H2,1-2H3 |
| InChIKey | CGTQECDXMJWWEM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-propan-2-yloxypropyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yloxypropyl formate?
The IUPAC name of 3-propan-2-yloxypropyl formate (CID 54266056) is 3-propan-2-yloxypropyl formate.
What is the SMILES notation for 3-propan-2-yloxypropyl formate?
The canonical SMILES for 3-propan-2-yloxypropyl formate is CC(C)OCCCOC=O.
What is the InChIKey of 3-propan-2-yloxypropyl formate?
The InChIKey is CGTQECDXMJWWEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3/c1-7(2)10-5-3-4-9-6-8/h6-7H,3-5H2,1-2H3.
What are the key properties of 3-propan-2-yloxypropyl formate?
3-propan-2-yloxypropyl formate has a molecular weight of 146.19 g/mol, XLogP of 0.97, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yloxypropyl formate is sourced from PubChem (CID 54266056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).