C24H23ClN4O — CID 54266313
3-[(2-chlorophenyl)methyl]-2-propyl-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide (PubChem CID 54266313) has the molecular formula C24H23ClN4O and a molecular weight of 418.93 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-2-propyl-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide.
| Compound Name | 3-[(2-chlorophenyl)methyl]-2-propyl-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 54266313 |
| Molecular Formula | C24H23ClN4O |
| Molecular Weight | 418.93 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-2-propyl-N-(pyridin-3-ylmethyl)benzimidazole-5-carboxamide |
| SMILES | CCCc1nc2ccc(C(=O)NCc3cccnc3)cc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C24H23ClN4O/c1-2-6-23-28-21-11-10-18(24(30)27-15-17-7-5-12-26-14-17)13-22(21)29(23)16-19-8-3-4-9-20(19)25/h3-5,7-14H,2,6,15-16H2,1H3,(H,27,30) |
| InChIKey | RGZWHDYTWQBSEQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.93 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |