C27H39N5S2 — CID 54266598
2-hexyl-N-[6-(1H-1,2,4-triazol-5-ylsulfanyl)quinolin-5-yl]decanethioamide (PubChem CID 54266598) has the molecular formula C27H39N5S2 and a molecular weight of 497.78 g/mol. Its IUPAC name is 2-hexyl-N-[6-(1H-1,2,4-triazol-5-ylsulfanyl)quinolin-5-yl]decanethioamide.
| Compound Name | 2-hexyl-N-[6-(1H-1,2,4-triazol-5-ylsulfanyl)quinolin-5-yl]decanethioamide |
|---|---|
| PubChem CID | 54266598 |
| Molecular Formula | C27H39N5S2 |
| Molecular Weight | 497.78 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 2-hexyl-N-[6-(1H-1,2,4-triazol-5-ylsulfanyl)quinolin-5-yl]decanethioamide |
| SMILES | CCCCCCCCC(CCCCCC)C(=S)Nc1c(Sc2ncn[nH]2)ccc2ncccc12 |
| InChI | InChI=1S/C27H39N5S2/c1-3-5-7-9-10-12-15-21(14-11-8-6-4-2)26(33)31-25-22-16-13-19-28-23(22)17-18-24(25)34-27-29-20-30-32-27/h13,16-21H,3-12,14-15H2,1-2H3,(H,31,33)(H,29,30,32) |
| InChIKey | RHEIEDIAUCQIAI-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.78 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|